|
CAS#: 32358-83-1 Product: Benzo[g][1]Benzoxole-8,9-Dione No suppilers available for the product. |
| Name | Benzo[g][1]Benzoxole-8,9-Dione |
|---|---|
| Synonyms | Benzo[G]Benzofuran-8,9-Dione; Benzo[G]Benzofuran-8,9-Quinone; Nf-4,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6O3 |
| Molecular Weight | 198.18 |
| CAS Registry Number | 32358-83-1 |
| SMILES | C2=CC1=CC=C3C(=C1O2)C(=O)C(=O)C=C3 |
| InChI | 1S/C12H6O3/c13-9-4-3-7-1-2-8-5-6-15-12(8)10(7)11(9)14/h1-6H |
| InChIKey | YXSJXRFEZBTTIF-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.376°C at 760 mmHg (Cal.) |
| Flash point | 172.31°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[g][1]Benzoxole-8,9-Dione |