|
CAS#: 32349-69-2 Product: 5,6-Dimethyltricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione No suppilers available for the product. |
| Name | 5,6-Dimethyltricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione |
|---|---|
| Synonyms | 7,8-dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 32349-69-2 |
| SMILES | CC1=C(C(=O)C(=O)C2C1C3CC2C=C3)C |
| InChI | 1S/C13H14O2/c1-6-7(2)12(14)13(15)11-9-4-3-8(5-9)10(6)11/h3-4,8-11H,5H2,1-2H3 |
| InChIKey | WMUDGOYDHACLBK-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.241°C at 760 mmHg (Cal.) |
| Flash point | 129.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethyltricyclo[6.2.1.02,7]Undeca-5,9-Diene-3,4-Dione |