|
CAS#: 32358-78-4 Product: 3,5-Dimethoxy-1,2-Naphthalenedione No suppilers available for the product. |
| Name | 3,5-Dimethoxy-1,2-Naphthalenedione |
|---|---|
| Synonyms | 1,2-Naphthoquinone, 3,5-dimethoxy-; 3,5-Dimethoxy-1,2-naphthalenedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 32358-78-4 |
| SMILES | O=C2C(/OC)=C\c1c(OC)cccc1C2=O |
| InChI | 1S/C12H10O4/c1-15-9-5-3-4-7-8(9)6-10(16-2)12(14)11(7)13/h3-6H,1-2H3 |
| InChIKey | ZETKYIRJBLHNKN-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.097°C at 760 mmHg (Cal.) |
| Flash point | 188.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethoxy-1,2-Naphthalenedione |