|
CAS#: 32363-53-4 Product: 2,6-Dimethyl-3-Phenyl-4(3H)-Pyrimidinone No suppilers available for the product. |
| Name | 2,6-Dimethyl-3-Phenyl-4(3H)-Pyrimidinone |
|---|---|
| Synonyms | 2,6-Dimethyl-3-phenyl-4(3H)-pyrimidinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 32363-53-4 |
| SMILES | O=C2/C=C(\N=C(/N2c1ccccc1)C)C |
| InChI | 1S/C12H12N2O/c1-9-8-12(15)14(10(2)13-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | GOJQLATUSQROKM-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.34°C at 760 mmHg (Cal.) |
| Flash point | 143.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-3-Phenyl-4(3H)-Pyrimidinone |