Online Database of Chemicals from Around the World
|
CAS#: 32388-58-2 Product: 1,2,3,4,7,7a-Hexahydro-1,4,4,5-Tetramethyl-6-Acetyl-1,3a-Ethano-3aH-Indene No suppilers available for the product. |
| Name | 1,2,3,4,7,7a-Hexahydro-1,4,4,5-Tetramethyl-6-Acetyl-1,3a-Ethano-3aH-Indene |
|---|---|
| Synonyms | Ethanone, 1-(1,2,3,4,7,7A-Hexahydro-1,4,4,5-Tetramethyl-1,3A-Ethano-3Ah-Inden-6-Yl)-; 4-Acetyl-2,2,3,7-Tetramethyltricyclo(5.2.2.0(1,6))Undec-3-Ene |
| Molecular Structure |  |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 |
| CAS Registry Number | 32388-58-2 |
| SMILES | CC3=C(CC1C2(CCC1(CC2)C3(C)C)C)C(=O)C |
| InChI | 1S/C17H26O/c1-11-13(12(2)18)10-14-16(5)6-8-17(14,9-7-16)15(11,3)4/h14H,6-10H2,1-5H3 |
| InChIKey | NVCKBQXBWJYISN-UHFFFAOYSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.606°C at 760 mmHg (Cal.) |
| Flash point | 139.592°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,7,7a-Hexahydro-1,4,4,5-Tetramethyl-6-Acetyl-1,3a-Ethano-3aH-Indene |