|
CAS#: 32607-00-4 Product: Sodium 2-(Carboxymethylamino)Acetate No suppilers available for the product. |
| Name | Sodium 2-(Carboxymethylamino)Acetate |
|---|---|
| Synonyms | Sodium 2-(Carboxymethylamino)Ethanoate; Sodium Iminodiacetate Monohydrate; Usaf Do-24 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6NNaO4 |
| Molecular Weight | 155.09 |
| CAS Registry Number | 32607-00-4 |
| SMILES | C(NCC(=O)O)C(=O)[O-].[Na+] |
| InChI | 1S/C4H7NO4.Na/c6-3(7)1-5-2-4(8)9;/h5H,1-2H2,(H,6,7)(H,8,9);/q;+1/p-1 |
| InChIKey | YMUIJWOIZMVBQZ-UHFFFAOYSA-M |
| Boiling point | 370.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 177.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-(Carboxymethylamino)Acetate |