|
CAS#: 329278-45-7 Product: 1-[(E)-Mesityldiazenyl]Pyrrolidine No suppilers available for the product. |
| Name | 1-[(E)-Mesityldiazenyl]Pyrrolidine |
|---|---|
| Synonyms | 1-(mesityldiazenyl)pyrrolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.31 |
| CAS Registry Number | 329278-45-7 |
| SMILES | CC1=CC(=C(C(=C1)C)/N=N/N2CCCC2)C |
| InChI | 1S/C13H19N3/c1-10-8-11(2)13(12(3)9-10)14-15-16-6-4-5-7-16/h8-9H,4-7H2,1-3H3/b15-14+ |
| InChIKey | UWKBSWPLFDIBRG-CCEZHUSRSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.4±52.0°C at 760 mmHg (Cal.) |
| Flash point | 159.7±30.7°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(E)-Mesityldiazenyl]Pyrrolidine |