|
CAS#: 33046-48-9 Product: 2-(4-Nitrophenyl)Sulfanyl-1-Phenylethanone No suppilers available for the product. |
| Name | 2-(4-Nitrophenyl)Sulfanyl-1-Phenylethanone |
|---|---|
| Synonyms | 2-(4-Nitrophenyl)Sulfanyl-1-Phenyl-Ethanone; 2-[(4-Nitrophenyl)Thio]-1-Phenylethanone; 2-[(4-Nitrophenyl)Thio]-1-Phenyl-Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 |
| CAS Registry Number | 33046-48-9 |
| SMILES | C2=C(C(CSC1=CC=C([N+](=O)[O-])C=C1)=O)C=CC=C2 |
| InChI | 1S/C14H11NO3S/c16-14(11-4-2-1-3-5-11)10-19-13-8-6-12(7-9-13)15(17)18/h1-9H,10H2 |
| InChIKey | MSDOBISTMBKIFE-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.769°C at 760 mmHg (Cal.) |
| Flash point | 225.813°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitrophenyl)Sulfanyl-1-Phenylethanone |