|
CAS#: 33077-70-2 Product: (4-Hydroxyphenyl)-Pyridin-2-Ylmethanone No suppilers available for the product. |
| Name | (4-Hydroxyphenyl)-Pyridin-2-Ylmethanone |
|---|---|
| Synonyms | (4-Hydroxyphenyl)-(2-Pyridyl)Methanone; (4-Hydroxyphenyl)-Pyridin-2-Yl-Methanone; Ketone, (P-Hydroxyphenyl) 2-Pyridyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 |
| CAS Registry Number | 33077-70-2 |
| EINECS | 251-368-6 |
| SMILES | C1=CC(=CC=C1C(C2=NC=CC=C2)=O)O |
| InChI | 1S/C12H9NO2/c14-10-6-4-9(5-7-10)12(15)11-3-1-2-8-13-11/h1-8,14H |
| InChIKey | ADNZLHSXIAPURS-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.75°C at 760 mmHg (Cal.) |
| Flash point | 192.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Hydroxyphenyl)-Pyridin-2-Ylmethanone |