|
CAS#: 33227-10-0 Product: Rubidium hydrogen phthalate No suppilers available for the product. |
| Name | Rubidium hydrogen phthalate |
|---|---|
| Synonyms | 1,2-Benzenedicarboxylic Acid, Monorubidium Salt; Rubidium Hydrogen Phthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5O4Rb |
| Molecular Weight | 250.59 |
| CAS Registry Number | 33227-10-0 |
| SMILES | C1=C(C(=CC=C1)C(=O)O)C([O-])=O.[Rb+] |
| InChI | 1S/C8H6O4.Rb/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | XESNEJYDNWIZHN-UHFFFAOYSA-M |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rubidium hydrogen phthalate |