|
CAS#: 33242-54-5 Product: 6-Bromo-2,4-Bis(Phenylmethyl)-1,2,4-Triazine-3,5-Dione No suppilers available for the product. |
| Name | 6-Bromo-2,4-Bis(Phenylmethyl)-1,2,4-Triazine-3,5-Dione |
|---|---|
| Synonyms | 2,4-Bis(Benzyl)-6-Bromo-1,2,4-Triazine-3,5-Quinone; 2,4-Dibenzyl-6-Bromo-1,2,4-Triazine-3,5(2H,4H)-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14BrN3O2 |
| Molecular Weight | 372.22 |
| CAS Registry Number | 33242-54-5 |
| EINECS | 251-423-4 |
| SMILES | C1=CC=CC=C1CN2C(N(N=C(C2=O)Br)CC3=CC=CC=C3)=O |
| InChI | 1S/C17H14BrN3O2/c18-15-16(22)20(11-13-7-3-1-4-8-13)17(23)21(19-15)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | YBZGYEZYYVYYCJ-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.826°C at 760 mmHg (Cal.) |
| Flash point | 244.595°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-2,4-Bis(Phenylmethyl)-1,2,4-Triazine-3,5-Dione |