|
CAS#: 33342-90-4 Product: 1-{2-[(Trimethylsilyl)Oxy]Phenyl}-1-Butanone No suppilers available for the product. |
| Name | 1-{2-[(Trimethylsilyl)Oxy]Phenyl}-1-Butanone |
|---|---|
| Synonyms | 1-(2-[(Trimethylsilyl)oxy]phenyl)-1-butanone #; Trimethylsilyl ether of o-hydroxybutyrophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.38 |
| CAS Registry Number | 33342-90-4 |
| SMILES | O=C(c1ccccc1O[Si](C)(C)C)CCC |
| InChI | 1S/C13H20O2Si/c1-5-8-12(14)11-9-6-7-10-13(11)15-16(2,3)4/h6-7,9-10H,5,8H2,1-4H3 |
| InChIKey | KHIFEKDNYSPSJA-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.562°C at 760 mmHg (Cal.) |
| Flash point | 102.173°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{2-[(Trimethylsilyl)Oxy]Phenyl}-1-Butanone |