Online Database of Chemicals from Around the World
|
CAS#: 33472-72-9 Product: (1-Methylpyrrolidin-3-Yl) N-(2-Methylphenyl)Carbamate No suppilers available for the product. |
| Name | (1-Methylpyrrolidin-3-Yl) N-(2-Methylphenyl)Carbamate |
|---|---|
| Synonyms | N-(2-Methylphenyl)Carbamic Acid (1-Methyl-3-Pyrrolidinyl) Ester; N-(2-Methylphenyl)Carbamic Acid (1-Methylpyrrolidin-3-Yl) Ester; Brn 1467542 |
| Molecular Structure |  |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 |
| CAS Registry Number | 33472-72-9 |
| SMILES | C2=C(NC(OC1CN(CC1)C)=O)C(=CC=C2)C |
| InChI | 1S/C13H18N2O2/c1-10-5-3-4-6-12(10)14-13(16)17-11-7-8-15(2)9-11/h3-6,11H,7-9H2,1-2H3,(H,14,16) |
| InChIKey | DTAAMVZDTXCCDV-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.425°C at 760 mmHg (Cal.) |
| Flash point | 135.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methylpyrrolidin-3-Yl) N-(2-Methylphenyl)Carbamate |