|
CAS#: 33522-69-9 Product: (4,7,7-Trimethyl-2-Bicyclo[3.1.1]Hept-3-Enyl) Acetate No suppilers available for the product. |
| Name | (4,7,7-Trimethyl-2-Bicyclo[3.1.1]Hept-3-Enyl) Acetate |
|---|---|
| Synonyms | Acetic Acid (4,7,7-Trimethyl-2-Bicyclo[3.1.1]Hept-3-Enyl) Ester; (4,7,7-Trimethyl-2-Bicyclo[3.1.1]Hept-3-Enyl) Ethanoate; Bicyclo[3.1.1]Hept-2-En-4-Ol, 2,6,6-Trimethyl-, Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 33522-69-9 |
| EINECS | 251-559-4 |
| SMILES | CC1(C2C(OC(=O)C)C=C(C1C2)C)C |
| InChI | 1S/C12H18O2/c1-7-5-11(14-8(2)13)10-6-9(7)12(10,3)4/h5,9-11H,6H2,1-4H3 |
| InChIKey | OZBFUQLOVFXDNK-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.128°C at 760 mmHg (Cal.) |
| Flash point | 85.298°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4,7,7-Trimethyl-2-Bicyclo[3.1.1]Hept-3-Enyl) Acetate |