|
CAS#: 33533-96-9 Product: Ethyl 6-Chlorochroman-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl 6-Chlorochroman-2-Carboxylate |
|---|---|
| Synonyms | 6-Chloro-2-Chromancarboxylic Acid Ethyl Ester; 6-Chlorochroman-2-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 |
| CAS Registry Number | 33533-96-9 |
| SMILES | C1=C2C(=CC(=C1)Cl)CCC(O2)C(=O)OCC |
| InChI | 1S/C12H13ClO3/c1-2-15-12(14)11-5-3-8-7-9(13)4-6-10(8)16-11/h4,6-7,11H,2-3,5H2,1H3 |
| InChIKey | WZZUMAXLNPKBKD-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.521°C at 760 mmHg (Cal.) |
| Flash point | 137.626°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-Chlorochroman-2-Carboxylate |