|
CAS#: 336165-69-6 Product: 2,4-Dimethoxy-N-{3-Methyl-1-Oxo-1-[(4-Phenoxyphenyl)Amino]-2-Butanyl}Benzamide No suppilers available for the product. |
| Name | 2,4-Dimethoxy-N-{3-Methyl-1-Oxo-1-[(4-Phenoxyphenyl)Amino]-2-Butanyl}Benzamide |
|---|---|
| Synonyms | BENZAMIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.51 |
| CAS Registry Number | 336165-69-6 |
| SMILES | CC(C)C(C(=O)Nc1ccc(cc1)Oc2ccccc2)NC(=O)c3ccc(cc3OC)OC |
| InChI | 1S/C26H28N2O5/c1-17(2)24(28-25(29)22-15-14-21(31-3)16-23(22)32-4)26(30)27-18-10-12-20(13-11-18)33-19-8-6-5-7-9-19/h5-17,24H,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | KPKLSPKLAZBMQM-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.339°C at 760 mmHg (Cal.) |
| Flash point | 347.717°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethoxy-N-{3-Methyl-1-Oxo-1-[(4-Phenoxyphenyl)Amino]-2-Butanyl}Benzamide |