|
CAS#: 3362-08-1 Product: 7-Chloro-4,5-epoxy-5-phenyl-2,3,4,5-tetrahydro-1,4-benzothiazepine 1,1-dioxide No suppilers available for the product. |
| Name | 7-Chloro-4,5-epoxy-5-phenyl-2,3,4,5-tetrahydro-1,4-benzothiazepine 1,1-dioxide |
|---|---|
| Synonyms | 1,4-Benzothiazepine, 2,3,4,5-Tetrahydro-7-Chloro-4,5-Epoxy-5-Phenyl-, 1,1-Dioxide; 7-Chloro-4,5-Epoxy-5-Phenyl-2,3,4,5-Tetrahydro-1,4-Benzothiazepine 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12ClNO3S |
| Molecular Weight | 321.78 |
| CAS Registry Number | 3362-08-1 |
| SMILES | C3=C2C1(ON1CC[S](=O)(=O)C2=CC=C3Cl)C4=CC=CC=C4 |
| InChI | 1S/C15H12ClNO3S/c16-12-6-7-14-13(10-12)15(11-4-2-1-3-5-11)17(20-15)8-9-21(14,18)19/h1-7,10H,8-9H2 |
| InChIKey | KPSPYIGRPWPSPY-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.631°C at 760 mmHg (Cal.) |
| Flash point | 255.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-4,5-epoxy-5-phenyl-2,3,4,5-tetrahydro-1,4-benzothiazepine 1,1-dioxide |