|
CAS#: 33709-29-4 Product: 1-(3,4,5-Trihydroxyphenyl)Ethanone No suppilers available for the product. |
| Name | 1-(3,4,5-Trihydroxyphenyl)Ethanone |
|---|---|
| Synonyms | 3,4,5-Trihydroxyacetophenone; Acetophenone, 3,4,5-Trihydroxy-; Brn 2446387 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 |
| CAS Registry Number | 33709-29-4 |
| SMILES | C1=C(C(=C(C=C1C(=O)C)O)O)O |
| InChI | 1S/C8H8O4/c1-4(9)5-2-6(10)8(12)7(11)3-5/h2-3,10-12H,1H3 |
| InChIKey | IBKQQKPQRYUGBJ-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.276°C at 760 mmHg (Cal.) |
| Flash point | 246.892°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4,5-Trihydroxyphenyl)Ethanone |