|
CAS#: 33731-54-3 Product: 2,6-Dimethyl-3,5-Di(Phenyl)Pyran-4-One No suppilers available for the product. |
| Name | 2,6-Dimethyl-3,5-Di(Phenyl)Pyran-4-One |
|---|---|
| Synonyms | 2,6-Dimethyl-3,5-Di(Phenyl)-4-Pyranone; Nsc54032 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 33731-54-3 |
| SMILES | C1=CC=CC=C1C3=C(C)OC(=C(C2=CC=CC=C2)C3=O)C |
| InChI | 1S/C19H16O2/c1-13-17(15-9-5-3-6-10-15)19(20)18(14(2)21-13)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | YCMLUTKKOKKIMN-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.994°C at 760 mmHg (Cal.) |
| Flash point | 219.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-3,5-Di(Phenyl)Pyran-4-One |