|
CAS#: 33781-72-5 Product: 1,3-Diethyl-2,4,5,6-Tetramethylbenzene No suppilers available for the product. |
| Name | 1,3-Diethyl-2,4,5,6-Tetramethylbenzene |
|---|---|
| Synonyms | 1,3-Diethyl-2,4,5,6-Tetramethyl-Benzene; Benzene, 1,3-Diethyl-2,4,5,6-Tetramethyl-; Nsc74926 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 |
| CAS Registry Number | 33781-72-5 |
| SMILES | C(C1=C(C(=C(C(=C1C)CC)C)C)C)C |
| InChI | 1S/C14H22/c1-7-13-10(4)9(3)11(5)14(8-2)12(13)6/h7-8H2,1-6H3 |
| InChIKey | AHRQHZJWGBZBMB-UHFFFAOYSA-N |
| Density | 0.864g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.641°C at 760 mmHg (Cal.) |
| Flash point | 116.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diethyl-2,4,5,6-Tetramethylbenzene |