|
CAS#: 33844-22-3 Product: 4-Methoxy-2-Nitrobenzamide No suppilers available for the product. |
| Name | 4-Methoxy-2-Nitrobenzamide |
|---|---|
| Synonyms | 4-Methoxy-2-Nitro-Benzamide; 2-Nitro-P-Anisamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 33844-22-3 |
| EINECS | 251-698-0 |
| SMILES | C1=C(C=CC(=C1[N+]([O-])=O)C(=O)N)OC |
| InChI | 1S/C8H8N2O4/c1-14-5-2-3-6(8(9)11)7(4-5)10(12)13/h2-4H,1H3,(H2,9,11) |
| InChIKey | QBDIKLOJLSJNTM-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.398°C at 760 mmHg (Cal.) |
| Flash point | 157.853°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-2-Nitrobenzamide |