|
CAS#: 34029-43-1 Product: Isoapomorphine No suppilers available for the product. |
| Name | Isoapomorphine |
|---|---|
| Synonyms | 5,6,6A,7-Tetrahydro-6-Methyl-4H-Dibenzo(De,G)Quinoline-9,10-Diol; 9,10-Dihydroxyaporphine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 |
| CAS Registry Number | 34029-43-1 |
| SMILES | [C@H]14N(CCC2=CC=CC(=C12)C3=CC(=C(O)C=C3C4)O)C |
| InChI | 1S/C17H17NO2/c1-18-6-5-10-3-2-4-12-13-9-16(20)15(19)8-11(13)7-14(18)17(10)12/h2-4,8-9,14,19-20H,5-7H2,1H3/t14-/m1/s1 |
| InChIKey | ISTXHGONSIOJQO-CQSZACIVSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.449°C at 760 mmHg (Cal.) |
| Flash point | 268.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isoapomorphine |