Online Database of Chemicals from Around the World
|
CAS#: 3414-70-8 Product: 3-(Morpholin-4-Ylmethyl)-5-Nitro-1H-Indole No suppilers available for the product. |
| Name | 3-(Morpholin-4-Ylmethyl)-5-Nitro-1H-Indole |
|---|---|
| Synonyms | 3-(Morpholinomethyl)-5-Nitro-1H-Indole; Indole, 3-(Morpholinomethyl)-5-Nitro-; 3-(Morpholinomethyl)-5-Nitroindole |
| Molecular Structure |  |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 |
| CAS Registry Number | 3414-70-8 |
| SMILES | C1=C(C=CC2=C1C(=C[NH]2)CN3CCOCC3)[N+](=O)[O-] |
| InChI | 1S/C13H15N3O3/c17-16(18)11-1-2-13-12(7-11)10(8-14-13)9-15-3-5-19-6-4-15/h1-2,7-8,14H,3-6,9H2 |
| InChIKey | LINZZROYNSDZPC-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.345°C at 760 mmHg (Cal.) |
| Flash point | 231.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Morpholin-4-Ylmethyl)-5-Nitro-1H-Indole |