|
CAS#: 3416-17-9 Product: 2-Methyl-N-[Tri(Phenyl)Methyl]Propan-1-Amine No suppilers available for the product. |
| Name | 2-Methyl-N-[Tri(Phenyl)Methyl]Propan-1-Amine |
|---|---|
| Synonyms | Isobutyl-[Tri(Phenyl)Methyl]Amine; Brn 2145899; Compound 24,223 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H25N |
| Molecular Weight | 315.46 |
| CAS Registry Number | 3416-17-9 |
| SMILES | C3=C(C(NCC(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C23H25N/c1-19(2)18-24-23(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19,24H,18H2,1-2H3 |
| InChIKey | DPJZYUYVRIVLJB-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.658°C at 760 mmHg (Cal.) |
| Flash point | 183.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-N-[Tri(Phenyl)Methyl]Propan-1-Amine |