Online Database of Chemicals from Around the World
|
CAS#: 34237-98-4 Product: 4-(4-Amino-3-Bromophenyl)-2-Bromoaniline No suppilers available for the product. |
| Name | 4-(4-Amino-3-Bromophenyl)-2-Bromoaniline |
|---|---|
| Synonyms | 4-(4-Amino-3-Bromo-Phenyl)-2-Bromo-Aniline; [4-(4-Amino-3-Bromo-Phenyl)-2-Bromo-Phenyl]Amine; (1,1'-Biphenyl)-4,4'-Diamine, 3,3'-Dibromo- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H10Br2N2 |
| Molecular Weight | 342.03 |
| CAS Registry Number | 34237-98-4 |
| SMILES | C2=C(C1=CC=C(N)C(=C1)Br)C=CC(=C2Br)N |
| InChI | 1S/C12H10Br2N2/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8/h1-6H,15-16H2 |
| InChIKey | QWUSZGIKGARVEC-UHFFFAOYSA-N |
| Density | 1.785g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.988°C at 760 mmHg (Cal.) |
| Flash point | 195.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Amino-3-Bromophenyl)-2-Bromoaniline |