|
CAS#: 34252-92-1 Product: 4-Tert-Butyl-1-(Chloromethyl)-2-Nitrobenzene No suppilers available for the product. |
| Name | 4-Tert-Butyl-1-(Chloromethyl)-2-Nitrobenzene |
|---|---|
| Synonyms | 4-Tert-Butyl-1-(Chloromethyl)-2-Nitro-Benzene; Nsc85295 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 |
| CAS Registry Number | 34252-92-1 |
| SMILES | C1=CC(=CC(=C1CCl)[N+]([O-])=O)C(C)(C)C |
| InChI | 1S/C11H14ClNO2/c1-11(2,3)9-5-4-8(7-12)10(6-9)13(14)15/h4-6H,7H2,1-3H3 |
| InChIKey | GHFQQNFGCXPTLV-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.439°C at 760 mmHg (Cal.) |
| Flash point | 132.477°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butyl-1-(Chloromethyl)-2-Nitrobenzene |