|
CAS#: 34262-29-8 Product: 2-(3-Aminophenyl)Sulfonylaniline No suppilers available for the product. |
| Name | 2-(3-Aminophenyl)Sulfonylaniline |
|---|---|
| Synonyms | [2-(3-Aminophenyl)Sulfonylphenyl]Amine; 2-((3-Aminophenyl)Sulphonyl)Benzenamine; Benzenamine, 2-((3-Aminophenyl)Sulphonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30 |
| CAS Registry Number | 34262-29-8 |
| SMILES | C2=C([S](=O)(=O)C1=C(N)C=CC=C1)C=CC=C2N |
| InChI | 1S/C12H12N2O2S/c13-9-4-3-5-10(8-9)17(15,16)12-7-2-1-6-11(12)14/h1-8H,13-14H2 |
| InChIKey | JTWAAMURZWNLLU-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.938°C at 760 mmHg (Cal.) |
| Flash point | 268.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Aminophenyl)Sulfonylaniline |