|
CAS#: 34319-19-2 Product: 1-Methyl-3-(4-Methylphenyl)Pyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | 1-Methyl-3-(4-Methylphenyl)Pyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 1-Methyl-3-(4-Methylphenyl)Pyrrolidine-2,5-Quinone; 2,5-Pyrrolidinedione, 1-Methyl-3-(4-Methylphenyl)-; 5-21-11-00208 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 34319-19-2 |
| SMILES | C1=CC(=CC=C1C2C(N(C(C2)=O)C)=O)C |
| InChI | 1S/C12H13NO2/c1-8-3-5-9(6-4-8)10-7-11(14)13(2)12(10)15/h3-6,10H,7H2,1-2H3 |
| InChIKey | ZTWJSSIJGHUYLK-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.102°C at 760 mmHg (Cal.) |
| Flash point | 169.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-(4-Methylphenyl)Pyrrolidine-2,5-Dione |