|
CAS#: 3432-25-5 Product: 1,3-Benzothiazol-2-Yl Dimethylaminomethanedithioate No suppilers available for the product. |
| Name | 1,3-Benzothiazol-2-Yl Dimethylaminomethanedithioate |
|---|---|
| Synonyms | Dimethylaminomethanedithioic Acid 1,3-Benzothiazol-2-Yl Ester; Nsc65288; Usaf T-7 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.38 |
| CAS Registry Number | 3432-25-5 |
| SMILES | C1=CC=CC2=C1N=C(S2)SC(N(C)C)=S |
| InChI | 1S/C10H10N2S3/c1-12(2)10(13)15-9-11-7-5-3-4-6-8(7)14-9/h3-6H,1-2H3 |
| InChIKey | DQXSUEZFMYQFSC-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.459°C at 760 mmHg (Cal.) |
| Flash point | 176.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Benzothiazol-2-Yl Dimethylaminomethanedithioate |