|
CAS#: 34347-58-5 Product: 14,24-Dimethyl-9,19-Cyclocholestan-3-Ol No suppilers available for the product. |
| Name | 14,24-Dimethyl-9,19-Cyclocholestan-3-Ol |
|---|---|
| Synonyms | 24-Methylpollinastanol; 9,19-Cycloergostan-3-Ol, 14-Methyl-, (3Beta,5Alpha,9Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.71 |
| CAS Registry Number | 34347-58-5 |
| SMILES | [C@H]24C1(C3(C1)[C@@H](CC2)C[C@@H](O)CC3)CC[C@]5(C4(CC[C@@H]5[C@@H](CC[C@@H](C(C)C)C)C)C)C |
| InChI | 1S/C29H50O/c1-19(2)20(3)7-8-21(4)24-12-13-27(6)25-10-9-22-17-23(30)11-14-28(22)18-29(25,28)16-15-26(24,27)5/h19-25,30H,7-18H2,1-6H3/t20-,21+,22-,23-,24+,25-,26+,27?,28?,29?/m0/s1 |
| InChIKey | OLYMLXYZIJLUMG-PASBPSRESA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.427°C at 760 mmHg (Cal.) |
| Flash point | 218.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14,24-Dimethyl-9,19-Cyclocholestan-3-Ol |