|
CAS#: 3447-87-8 Product: 1,3,4,6,7,8,8-Heptachlorohexahydro-4,7-Methanoisobenzofuran-5(3H)-One No suppilers available for the product. |
| Name | 1,3,4,6,7,8,8-Heptachlorohexahydro-4,7-Methanoisobenzofuran-5(3H)-One |
|---|---|
| Synonyms | 4,7-Methanoisobenzofuran-5(3H)-One, 1,3,4,6,7,8,8-Heptachlorohexahydro-; Ent 27,236; Hrs 1671 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5Cl7O2 |
| Molecular Weight | 393.31 |
| CAS Registry Number | 3447-87-8 |
| SMILES | O=C1C2(C3C(C(C1Cl)(C2(Cl)Cl)Cl)C(OC3Cl)Cl)Cl |
| InChI | 1S/C9H5Cl7O2/c10-3-4(17)8(14)2-1(5(11)18-6(2)12)7(3,13)9(8,15)16/h1-3,5-6H |
| InChIKey | KPHDFTRBKVDNNB-UHFFFAOYSA-N |
| Density | 1.878g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.607°C at 760 mmHg (Cal.) |
| Flash point | 193.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,6,7,8,8-Heptachlorohexahydro-4,7-Methanoisobenzofuran-5(3H)-One |