|
CAS#: 3457-92-9 Product: 5-Nitrooxypentyl Nitrate No suppilers available for the product. |
| Name | 5-Nitrooxypentyl Nitrate |
|---|---|
| Synonyms | Nitric Acid 5-Nitrooxypentyl Ester; 1,5-Pentanediol, Dinitrate; Pentamethylene Dinitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10N2O6 |
| Molecular Weight | 194.14 |
| CAS Registry Number | 3457-92-9 |
| SMILES | C(O[N+]([O-])=O)CCCCO[N+]([O-])=O |
| InChI | 1S/C5H10N2O6/c8-6(9)12-4-2-1-3-5-13-7(10)11/h1-5H2 |
| InChIKey | MIYIEPHJPVBSEV-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.425°C at 760 mmHg (Cal.) |
| Flash point | 127.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitrooxypentyl Nitrate |