|
CAS#: 3458-35-3 Product: 2-(Phenylmethyl)-1-(Phenylmethylideneamino)Guanidine No suppilers available for the product. |
| Name | 2-(Phenylmethyl)-1-(Phenylmethylideneamino)Guanidine |
|---|---|
| Synonyms | 2-(Phenylmethyl)-1-(Phenylmethyleneamino)Guanidine; 2-(Benzyl)-1-(Benzylideneamino)Guanidine; 1-Benzyl-3-(Benzylideneamino)Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 |
| CAS Registry Number | 3458-35-3 |
| SMILES | C2=C(CN=C(N\N=C\C1=CC=CC=C1)N)C=CC=C2 |
| InChI | 1S/C15H16N4/c16-15(17-11-13-7-3-1-4-8-13)19-18-12-14-9-5-2-6-10-14/h1-10,12H,11H2,(H3,16,17,19)/b18-12+ |
| InChIKey | CPMKRFFCBDRVSY-LDADJPATSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.379°C at 760 mmHg (Cal.) |
| Flash point | 205.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylmethyl)-1-(Phenylmethylideneamino)Guanidine |