|
CAS#: 3459-06-1 Product: 1-Cyclopentyl-N-Methylpropan-2-Amine Hydrochloride No suppilers available for the product. |
| Name | 1-Cyclopentyl-N-Methylpropan-2-Amine Hydrochloride |
|---|---|
| Synonyms | 1-Cyclopentyl-N-Methyl-Propan-2-Amine Hydrochloride; (2-Cyclopentyl-1-Methyl-Ethyl)-Methyl-Amine Hydrochloride; (+-)-Cyclopentamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 |
| CAS Registry Number | 3459-06-1 |
| SMILES | [H+].C(C1CCCC1)C(NC)C.[Cl-] |
| InChI | 1S/C9H19N.ClH/c1-8(10-2)7-9-5-3-4-6-9;/h8-10H,3-7H2,1-2H3;1H |
| InChIKey | XGZPRABQSGUFBL-UHFFFAOYSA-N |
| Boiling point | 171.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 45.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Cyclopentyl-N-Methylpropan-2-Amine Hydrochloride |