|
CAS#: 3459-58-3 Product: 3-Furan-2-Yl-2-(2-Methylnaphthalen-1-Yl)Propanoic Acid No suppilers available for the product. |
| Name | 3-Furan-2-Yl-2-(2-Methylnaphthalen-1-Yl)Propanoic Acid |
|---|---|
| Synonyms | 3-(2-Furyl)-2-(2-Methyl-1-Naphthyl)Propanoic Acid; 3-(2-Furyl)-2-(2-Methyl-1-Naphthyl)Propionic Acid; 5-18-06-00655 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 3459-58-3 |
| SMILES | C1=CC=CC2=C1C(=C(C=C2)C)C(CC3=CC=CO3)C(O)=O |
| InChI | 1S/C18H16O3/c1-12-8-9-13-5-2-3-7-15(13)17(12)16(18(19)20)11-14-6-4-10-21-14/h2-10,16H,11H2,1H3,(H,19,20) |
| InChIKey | GEOODLRPOTYCMR-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.439°C at 760 mmHg (Cal.) |
| Flash point | 213.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Furan-2-Yl-2-(2-Methylnaphthalen-1-Yl)Propanoic Acid |