|
CAS#: 34604-38-1 Product: Phenyl mercury ammonium acetate No suppilers available for the product. |
| Name | Phenyl mercury ammonium acetate |
|---|---|
| Synonyms | Acetoxy-Phenyl-Mercury; Ammonia; Acetoxy-Phenylmercury; Ammonia; Acetyloxy-Phenyl-Mercury; Azane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11HgNO2 |
| Molecular Weight | 353.77 |
| CAS Registry Number | 34604-38-1 (53404-67-4) |
| SMILES | C1=C([Hg]OC(=O)C)C=CC=C1.N |
| InChI | 1S/C6H5.C2H4O2.Hg.H3N/c1-2-4-6-5-3-1;1-2(3)4;;/h1-5H;1H3,(H,3,4);;1H3/q;;+1;/p-1 |
| InChIKey | LPDJEBDOSVRHKE-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Phenyl mercury ammonium acetate |