|
CAS#: 3464-15-1 Product: 3,3-Di(Phenyl)Pyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | 3,3-Di(Phenyl)Pyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 3,3-Di(Phenyl)Pyrrolidine-2,5-Quinone; 2,5-Pyrrolidinedione, 3,3-Diphenyl-; Alpha,Alpha-Diphenylsuccinimide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 3464-15-1 |
| SMILES | C3=C(C2(C1=CC=CC=C1)CC(=O)NC2=O)C=CC=C3 |
| InChI | 1S/C16H13NO2/c18-14-11-16(15(19)17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,17,18,19) |
| InChIKey | NQCRYUGXPSKTBG-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.404°C at 760 mmHg (Cal.) |
| Flash point | 183.163°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Di(Phenyl)Pyrrolidine-2,5-Dione |