|
CAS#: 34691-05-9 Product: 2-Butylaminopropan-2-Ylphosphonic Acid No suppilers available for the product. |
| Name | 2-Butylaminopropan-2-Ylphosphonic Acid |
|---|---|
| Synonyms | (1-Butylamino-1-Methyl-Ethyl)Phosphonic Acid; (1-Butylamino-1-Methylethyl)Phosphonic Acid; (1-(Butylamino)-1-Methylethyl)Phosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H18NO3P |
| Molecular Weight | 195.20 |
| CAS Registry Number | 34691-05-9 |
| SMILES | C(NC(C)(C)[P](=O)(O)O)CCC |
| InChI | 1S/C7H18NO3P/c1-4-5-6-8-7(2,3)12(9,10)11/h8H,4-6H2,1-3H3,(H2,9,10,11) |
| InChIKey | VNEJPLLPMHBPNK-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.737°C at 760 mmHg (Cal.) |
| Flash point | 148.382°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butylaminopropan-2-Ylphosphonic Acid |