|
CAS#: 34701-98-9 Product: (2-Chlorophenyl)-(4-Phenylphenyl)Methanone No suppilers available for the product. |
| Name | (2-Chlorophenyl)-(4-Phenylphenyl)Methanone |
|---|---|
| Synonyms | (1,1-Biphenyl)-4-Yl(2-Chlorophenyl)Methanone; 2-Chloro-4'-Phenylbenzophenone; 3-07-00-02731 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13ClO |
| Molecular Weight | 292.76 |
| CAS Registry Number | 34701-98-9 |
| EINECS | 252-160-8 |
| SMILES | C1=CC(=CC=C1C2=CC=CC=C2)C(C3=CC=CC=C3Cl)=O |
| InChI | 1S/C19H13ClO/c20-18-9-5-4-8-17(18)19(21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-13H |
| InChIKey | ZSENJSDVZBWPKH-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.978°C at 760 mmHg (Cal.) |
| Flash point | 259.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chlorophenyl)-(4-Phenylphenyl)Methanone |