|
CAS#: 34987-62-7 Product: 1,2-Di(Phenyl)-2,3-Dihydro-1H-Indene No suppilers available for the product. |
| Name | 1,2-Di(Phenyl)-2,3-Dihydro-1H-Indene |
|---|---|
| Synonyms | 1,2-Di(Phenyl)Indane; 1,2-Diphenylindan; 1H-Indene, 2,3-Dihydro-1,2-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 34987-62-7 |
| SMILES | C1=CC=C(C=C1)C3C2=C(C=CC=C2)CC3C4=CC=CC=C4 |
| InChI | 1S/C21H18/c1-3-9-16(10-4-1)20-15-18-13-7-8-14-19(18)21(20)17-11-5-2-6-12-17/h1-14,20-21H,15H2 |
| InChIKey | VYSINWOCMRTCLM-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.867°C at 760 mmHg (Cal.) |
| Flash point | 167.705°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Di(Phenyl)-2,3-Dihydro-1H-Indene |