|
CAS#: 35047-67-7 Product: 2-Diethylaminoethyl 2,5-Diphenylpentanoate Hydrochloride No suppilers available for the product. |
| Name | 2-Diethylaminoethyl 2,5-Diphenylpentanoate Hydrochloride |
|---|---|
| Synonyms | 2,5-Diphenylpentanoic Acid 2-Diethylaminoethyl Ester Hydrochloride; Alpha-Phenylbenzenepentanoic Acid 2-(Diethylamino)Ethyl Ester Hydrochloride; 2,5-Diphenylvaleric Acid 2-Diethylaminoethyl Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C23H32ClNO2 |
| Molecular Weight | 389.96 |
| CAS Registry Number | 35047-67-7 |
| SMILES | [H+].C2=C(C(C(OCCN(CC)CC)=O)CCCC1=CC=CC=C1)C=CC=C2.[Cl-] |
| InChI | 1S/C23H31NO2.ClH/c1-3-24(4-2)18-19-26-23(25)22(21-15-9-6-10-16-21)17-11-14-20-12-7-5-8-13-20;/h5-10,12-13,15-16,22H,3-4,11,14,17-19H2,1-2H3;1H |
| InChIKey | YLMKFVHTTDHIMQ-UHFFFAOYSA-N |
| Boiling point | 461.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 132.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Diethylaminoethyl 2,5-Diphenylpentanoate Hydrochloride |