|
CAS#: 35109-57-0 Product: Dehydroabietylammonium pentachlorophenoxide No suppilers available for the product. |
| Name | Dehydroabietylammonium pentachlorophenoxide |
|---|---|
| Synonyms | [(1R,4As)-7-Isopropyl-1,4A-Dimethyl-2,3,4,9,10,10A-Hexahydrophenanthren-1-Yl]Methanamine; 2,3,4,5,6-Pentachlorophenol; [(1R,4As)-7-Isopropyl-1,4A-Dimethyl-2,3,4,9,10,10A-Hexahydrophenanthren-1-Yl]Methylamine; 2,3,4,5,6-Pentachlorophenol; Caswell No. 277A |
| Molecular Structure | ![]() |
| Molecular Formula | C26H32Cl5NO |
| Molecular Weight | 551.81 |
| CAS Registry Number | 35109-57-0 |
| EINECS | 252-371-5 |
| SMILES | [C@]12(C([C@@](CCC1)(CN)C)CCC3=CC(=CC=C23)C(C)C)C.C4(=C(Cl)C(=C(O)C(=C4Cl)Cl)Cl)Cl |
| InChI | 1S/C20H31N.C6HCl5O/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4;7-1-2(8)4(10)6(12)5(11)3(1)9/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3;12H/t18?,19-,20+;/m0./s1 |
| InChIKey | FQHFSZCYOUJICQ-MGPZMBRGSA-N |
| Boiling point | 382.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 156.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydroabietylammonium pentachlorophenoxide |