|
CAS#: 3513-93-7 Product: 1,2,3,4,7,7-Hexachloro-6-(Dichloromethyl)Bicyclo[2.2.1]Hept-2-Ene No suppilers available for the product. |
| Name | 1,2,3,4,7,7-Hexachloro-6-(Dichloromethyl)Bicyclo[2.2.1]Hept-2-Ene |
|---|---|
| Synonyms | 2-Norbornene, 1,2,3,4,7,7-Hexachloro-5-(Dichloromethyl)-; Ent 23,447; Hercules 426-A |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl8 |
| Molecular Weight | 383.74 |
| CAS Registry Number | 3513-93-7 |
| SMILES | C(C2C1(C(C(C(=C1Cl)Cl)(C2)Cl)(Cl)Cl)Cl)(Cl)Cl |
| InChI | 1S/C8H4Cl8/c9-3-4(10)7(14)2(5(11)12)1-6(3,13)8(7,15)16/h2,5H,1H2 |
| InChIKey | IFACMWNIOXNWER-UHFFFAOYSA-N |
| Density | 1.815g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.894°C at 760 mmHg (Cal.) |
| Flash point | 186.88°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,7,7-Hexachloro-6-(Dichloromethyl)Bicyclo[2.2.1]Hept-2-Ene |