|
CAS#: 3514-26-9 Product: 9-Dehydrohecogenin No suppilers available for the product. |
| Name | 9-Dehydrohecogenin |
|---|---|
| Synonyms | Spirost-9(11)-En-12-One, 3-Hydroxy-, (3Beta,5Alpha,25R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 |
| CAS Registry Number | 3514-26-9 |
| SMILES | [C@]34([C@@H]2[C@@H](OC1(OC[C@@H](CC1)C)[C@H]2C)C[C@H]3[C@H]5C(=CC4=O)[C@@]6([C@@H](CC5)C[C@@H](O)CC6)C)C |
| InChI | 1S/C27H40O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)12-21-19-6-5-17-11-18(28)8-9-25(17,3)20(19)13-23(29)26(21,24)4/h13,15-19,21-22,24,28H,5-12,14H2,1-4H3/t15-,16+,17+,18+,19-,21+,22+,24+,25+,26-,27?/m1/s1 |
| InChIKey | YLZUMNXGXFXZNQ-BFNYJZFJSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.547°C at 760 mmHg (Cal.) |
| Flash point | 185.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Dehydrohecogenin |