|
CAS#: 35154-55-3 Product: 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxychromen-4-One No suppilers available for the product. |
| Name | 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxychromen-4-One |
|---|---|
| Synonyms | 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxy-Chromen-4-One; 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxy-4-Chromenone; 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 |
| CAS Registry Number | 35154-55-3 |
| SMILES | C3=C(C2=C(C(C1=C(C(=C(OC)C(=C1O2)OC)OC)OC)=O)O)C=CC(=C3OC)OC |
| InChI | 1S/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-15(23)14(22)13-17(26-3)19(27-4)21(29-6)20(28-5)18(13)30-16/h7-9,23H,1-6H3 |
| InChIKey | CCJBNIRSVUKABH-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.349°C at 760 mmHg (Cal.) |
| Flash point | 212.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dimethoxyphenyl)-3-Hydroxy-5,6,7,8-Tetramethoxychromen-4-One |