|
CAS#: 35170-70-8 Product: 4,11-Diamino-2-Octylnaphtho[3,2-f]Isoindole-1,3,5,10-Tetrone No suppilers available for the product. |
| Name | 4,11-Diamino-2-Octylnaphtho[3,2-f]Isoindole-1,3,5,10-Tetrone |
|---|---|
| Synonyms | 4,11-Diamino-2-Octyl-Naphtho[3,2-F]Isoindole-1,3,5,10-Tetrone; 4,11-Diamino-2-Octyl-Naphtho[3,2-F]Isoindole-1,3,5,10-Diquinone; 2,3-Anthracenedicarboximide, 1,4-Diamino-9,10-Dihydro-N-Octyl-9,10-Dioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 |
| CAS Registry Number | 35170-70-8 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=C4C(=C3N)C(=O)N(C4=O)CCCCCCCC)N |
| InChI | 1S/C24H25N3O4/c1-2-3-4-5-6-9-12-27-23(30)17-18(24(27)31)20(26)16-15(19(17)25)21(28)13-10-7-8-11-14(13)22(16)29/h7-8,10-11H,2-6,9,12,25-26H2,1H3 |
| InChIKey | PIMCCBPBDJBTCL-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 681.957°C at 760 mmHg (Cal.) |
| Flash point | 366.234°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,11-Diamino-2-Octylnaphtho[3,2-f]Isoindole-1,3,5,10-Tetrone |