|
CAS#: 35215-31-7 Product: 2,7,12-Trimethylbenzo[a]Anthracene No suppilers available for the product. |
| Name | 2,7,12-Trimethylbenzo[a]Anthracene |
|---|---|
| Synonyms | Benz(A)Anthracene, 2,7,12-Trimethyl-; 2,7,12-Trimethylbenz(A)Anthracene; Brn 2332591 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 35215-31-7 |
| SMILES | C4=CC3=CC=C2C(=C1C=CC=CC1=C(C)C2=C3C=C4C)C |
| InChI | 1S/C21H18/c1-13-8-9-16-10-11-19-14(2)17-6-4-5-7-18(17)15(3)21(19)20(16)12-13/h4-12H,1-3H3 |
| InChIKey | ZMRPKSZAJUNIAT-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.428°C at 760 mmHg (Cal.) |
| Flash point | 236.113°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7,12-Trimethylbenzo[a]Anthracene |