|
CAS#: 3523-95-3 Product: 5-[(4-Aminophenyl)Sulfonylamino]-1,3,4-Thiadiazole-2-Sulfonamide No suppilers available for the product. |
| Name | 5-[(4-Aminophenyl)Sulfonylamino]-1,3,4-Thiadiazole-2-Sulfonamide |
|---|---|
| Synonyms | Nci60_036197; 5-{[(4-Aminophenyl)Sulfonyl]Amino}-1,3,4-Thiadiazole-2-Sulfonamide; Aids-098001 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O4S3 |
| Molecular Weight | 335.37 |
| CAS Registry Number | 3523-95-3 |
| SMILES | C2=C([S](=O)(=O)NC1=NN=C([S](=O)(=O)N)S1)C=CC(=C2)N |
| InChI | 1S/C8H9N5O4S3/c9-5-1-3-6(4-2-5)20(16,17)13-7-11-12-8(18-7)19(10,14)15/h1-4H,9H2,(H,11,13)(H2,10,14,15) |
| InChIKey | BDLSLORLEPSOGW-UHFFFAOYSA-N |
| Density | 1.806g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.834°C at 760 mmHg (Cal.) |
| Flash point | 348.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(4-Aminophenyl)Sulfonylamino]-1,3,4-Thiadiazole-2-Sulfonamide |