|
CAS#: 35249-69-5 Product: Disodium 2-(2-Oxido-2-Oxoethoxy)Acetate No suppilers available for the product. |
| Name | Disodium 2-(2-Oxido-2-Oxoethoxy)Acetate |
|---|---|
| Synonyms | Disodium 2-(2-Oxido-2-Oxo-Ethoxy)Acetate; Disodium 2-(2-Keto-2-Oxido-Ethoxy)Acetate; Disodium 2-(2-Oxido-2-Oxo-Ethoxy)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4Na2O5 |
| Molecular Weight | 178.05 |
| CAS Registry Number | 35249-69-5 |
| SMILES | C(OCC([O-])=O)C([O-])=O.[Na+].[Na+] |
| InChI | 1S/C4H6O5.2Na/c5-3(6)1-9-2-4(7)8;;/h1-2H2,(H,5,6)(H,7,8);;/q;2*+1/p-2 |
| InChIKey | IILQHMMTOSAJAR-UHFFFAOYSA-L |
| Boiling point | 445.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium 2-(2-Oxido-2-Oxoethoxy)Acetate |