|
CAS#: 35256-03-2 Product: Poly(beta-benzyl-L-aspartate-co-L-leucine) No suppilers available for the product. |
| Name | Poly(beta-benzyl-L-aspartate-co-L-leucine) |
|---|---|
| Synonyms | (2S)-2-Amino-4-Benzyloxy-4-Oxo-Butanoic Acid; (2S)-2-Amino-4-Methyl-Pentanoic Acid; (2S)-2-Amino-4-Benzyloxy-4-Oxobutanoic Acid; (2S)-2-Amino-4-Methylpentanoic Acid; (2S)-2-Amino-4-Benzoxy-4-Keto-Butyric Acid; (2S)-2-Amino-4-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 |
| CAS Registry Number | 35256-03-2 |
| SMILES | [C@H](N)(CC(OCC1=CC=CC=C1)=O)C(=O)O.[C@@H](N)(C(=O)O)CC(C)C |
| InChI | 1S/C11H13NO4.C6H13NO2/c12-9(11(14)15)6-10(13)16-7-8-4-2-1-3-5-8;1-4(2)3-5(7)6(8)9/h1-5,9H,6-7,12H2,(H,14,15);4-5H,3,7H2,1-2H3,(H,8,9)/t9-;5-/m00/s1 |
| InChIKey | LKPZLJOMPMXHSZ-LMECJBHSSA-N |
| Boiling point | 413.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 203.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(beta-benzyl-L-aspartate-co-L-leucine) |